C17H17FO2 — CID 134934694
(2S)-2-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-phenylbutan-1-one (PubChem CID 134934694) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is (2S)-2-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-phenylbutan-1-one.
| Compound Name | (2S)-2-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 134934694 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2S)-2-[(R)-(4-fluorophenyl)-hydroxymethyl]-1-phenylbutan-1-one |
| SMILES | CC[C@H](C(=O)c1ccccc1)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FO2/c1-2-15(16(19)12-6-4-3-5-7-12)17(20)13-8-10-14(18)11-9-13/h3-11,15,17,20H,2H2,1H3/t15-,17+/m1/s1 |
| InChIKey | USUYAQGRNYPNJO-WBVHZDCISA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |