C19H20O3 — CID 173016396
2-ethyl-3-methoxy-1,4-diphenylbutane-1,4-dione (PubChem CID 173016396) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-ethyl-3-methoxy-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2-ethyl-3-methoxy-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 173016396 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-ethyl-3-methoxy-1,4-diphenylbutane-1,4-dione |
| SMILES | CCC(C(=O)c1ccccc1)C(OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O3/c1-3-16(17(20)14-10-6-4-7-11-14)19(22-2)18(21)15-12-8-5-9-13-15/h4-13,16,19H,3H2,1-2H3 |
| InChIKey | QXGUZLZXOWEVQI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |