C12H16O2 — CID 129384215
(2R,3R)-2-hydroxy-3-methyl-1-phenylpentan-1-one (PubChem CID 129384215) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-methyl-1-phenylpentan-1-one.
| Compound Name | (2R,3R)-2-hydroxy-3-methyl-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 129384215 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-methyl-1-phenylpentan-1-one |
| SMILES | CC[C@@H](C)[C@@H](O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-3-9(2)11(13)12(14)10-7-5-4-6-8-10/h4-9,11,13H,3H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | JQHODLMBASPPLL-MWLCHTKSSA-N |
| XLogP | 2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |