C12H16O4 — CID 176900279
2,3,4-trihydroxy-1-phenylhexan-1-one (PubChem CID 176900279) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,3,4-trihydroxy-1-phenylhexan-1-one.
| Compound Name | 2,3,4-trihydroxy-1-phenylhexan-1-one |
|---|---|
| PubChem CID | 176900279 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2,3,4-trihydroxy-1-phenylhexan-1-one |
| SMILES | CCC(O)C(O)C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O4/c1-2-9(13)11(15)12(16)10(14)8-6-4-3-5-7-8/h3-7,9,11-13,15-16H,2H2,1H3 |
| InChIKey | WXMUOLLNLVJNOX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |