C18H18O3 — CID 10802844
(2S,3S)-2-hydroxy-3-methyl-1,5-diphenylpentane-1,5-dione (PubChem CID 10802844) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-3-methyl-1,5-diphenylpentane-1,5-dione.
| Compound Name | (2S,3S)-2-hydroxy-3-methyl-1,5-diphenylpentane-1,5-dione |
|---|---|
| PubChem CID | 10802844 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (2S,3S)-2-hydroxy-3-methyl-1,5-diphenylpentane-1,5-dione |
| SMILES | C[C@@H](CC(=O)c1ccccc1)[C@H](O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O3/c1-13(12-16(19)14-8-4-2-5-9-14)17(20)18(21)15-10-6-3-7-11-15/h2-11,13,17,20H,12H2,1H3/t13-,17-/m0/s1 |
| InChIKey | UVZVCGRQWREMLC-GUYCJALGSA-N |
| XLogP | 3.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |