C25H22O3 — CID 10547136
3-phenacyl-1,5-diphenylpentane-1,5-dione (PubChem CID 10547136) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-phenacyl-1,5-diphenylpentane-1,5-dione.
| Compound Name | 3-phenacyl-1,5-diphenylpentane-1,5-dione |
|---|---|
| PubChem CID | 10547136 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-phenacyl-1,5-diphenylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccccc1)CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22O3/c26-23(20-10-4-1-5-11-20)16-19(17-24(27)21-12-6-2-7-13-21)18-25(28)22-14-8-3-9-15-22/h1-15,19H,16-18H2 |
| InChIKey | ZFVSZILHFGMCTD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |