C15H14F2O2 — CID 159485423
1,3-diphenylpropane-1,3-dione;dihydrofluoride (PubChem CID 159485423) has the molecular formula C15H14F2O2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 1,3-diphenylpropane-1,3-dione;dihydrofluoride.
| Compound Name | 1,3-diphenylpropane-1,3-dione;dihydrofluoride |
|---|---|
| PubChem CID | 159485423 |
| Molecular Formula | C15H14F2O2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1,3-diphenylpropane-1,3-dione;dihydrofluoride |
| SMILES | F.F.O=C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O2.2FH/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;;/h1-10H,11H2;2*1H |
| InChIKey | LXNCSWQBCDDXPM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|