About silver 3-oxo-3-phenylpropanoate
silver 3-oxo-3-phenylpropanoate (PubChem CID 86633512) has the molecular formula C9H7AgO3
and a molecular weight of 271.02 g/mol. Its IUPAC name is silver 3-oxo-3-phenylpropanoate.
Molecular Properties
| Compound Name | silver 3-oxo-3-phenylpropanoate |
| PubChem CID | 86633512 |
| Molecular Formula | C9H7AgO3 |
| Molecular Weight | 271.02 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | silver 3-oxo-3-phenylpropanoate |
| SMILES | O=C([O-])CC(=O)c1ccccc1.[Ag+] |
| InChI | InChI=1S/C9H8O3.Ag/c10-8(6-9(11)12)7-4-2-1-3-5-7;/h1-5H,6H2,(H,11,12);/q;+1/p-1 |
| InChIKey | IHPDLWRQAUIWEQ-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.02 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze silver 3-oxo-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 3-oxo-3-phenylpropanoate?
The IUPAC name of silver 3-oxo-3-phenylpropanoate (CID 86633512) is silver 3-oxo-3-phenylpropanoate.
What is the SMILES notation for silver 3-oxo-3-phenylpropanoate?
The canonical SMILES for silver 3-oxo-3-phenylpropanoate is O=C([O-])CC(=O)c1ccccc1.[Ag+].
What is the InChIKey of silver 3-oxo-3-phenylpropanoate?
The InChIKey is IHPDLWRQAUIWEQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O3.Ag/c10-8(6-9(11)12)7-4-2-1-3-5-7;/h1-5H,6H2,(H,11,12);/q;+1/p-1.
What are the key properties of silver 3-oxo-3-phenylpropanoate?
silver 3-oxo-3-phenylpropanoate has a molecular weight of 271.02 g/mol, XLogP of 0.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver 3-oxo-3-phenylpropanoate is sourced from PubChem (CID 86633512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).