C10H10ErO2 — CID 175058632
erbium;1-phenylbutane-1,3-dione (PubChem CID 175058632) has the molecular formula C10H10ErO2 and a molecular weight of 329.45 g/mol. Its IUPAC name is erbium;1-phenylbutane-1,3-dione.
| Compound Name | erbium;1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 175058632 |
| Molecular Formula | C10H10ErO2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | erbium;1-phenylbutane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccccc1.[Er] |
| InChI | InChI=1S/C10H10O2.Er/c1-8(11)7-10(12)9-5-3-2-4-6-9;/h2-6H,7H2,1H3; |
| InChIKey | FQXVWBHTTRYXNJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|