About acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione
acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione (PubChem CID 174984609) has the molecular formula C24H38O8
and a molecular weight of 454.56 g/mol. Its IUPAC name is acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione.
Molecular Properties
| Compound Name | acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione |
| PubChem CID | 174984609 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccccc1.CC(=O)OOC(C)=O.CCCCCOOCCCCC |
| InChI | InChI=1S/C10H10O2.C10H22O2.C4H6O4/c1-8(11)7-10(12)9-5-3-2-4-6-9;1-3-5-7-9-11-12-10-8-6-4-2;1-3(5)7-8-4(2)6/h2-6H,7H2,1H3;3-10H2,1-2H3;1-2H3 |
| InChIKey | VUOPNUCXPJPRAU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione?
The IUPAC name of acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione (CID 174984609) is acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione.
What is the SMILES notation for acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione?
The canonical SMILES for acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione is CC(=O)CC(=O)c1ccccc1.CC(=O)OOC(C)=O.CCCCCOOCCCCC.
What is the InChIKey of acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione?
The InChIKey is VUOPNUCXPJPRAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C10H22O2.C4H6O4/c1-8(11)7-10(12)9-5-3-2-4-6-9;1-3-5-7-9-11-12-10-8-6-4-2;1-3(5)7-8-4(2)6/h2-6H,7H2,1H3;3-10H2,1-2H3;1-2H3.
What are the key properties of acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione?
acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione has a molecular weight of 454.56 g/mol, XLogP of 5.19, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl ethaneperoxoate;1-pentylperoxypentane;1-phenylbutane-1,3-dione is sourced from PubChem (CID 174984609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).