About hexyl 4-oxo-4-phenylbutanoate
hexyl 4-oxo-4-phenylbutanoate (PubChem CID 12510433) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is hexyl 4-oxo-4-phenylbutanoate.
Molecular Properties
| Compound Name | hexyl 4-oxo-4-phenylbutanoate |
| PubChem CID | 12510433 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | hexyl 4-oxo-4-phenylbutanoate |
| SMILES | CCCCCCOC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O3/c1-2-3-4-8-13-19-16(18)12-11-15(17)14-9-6-5-7-10-14/h5-7,9-10H,2-4,8,11-13H2,1H3 |
| InChIKey | IAEQYGYQJWEOJJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 4-oxo-4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 4-oxo-4-phenylbutanoate?
The IUPAC name of hexyl 4-oxo-4-phenylbutanoate (CID 12510433) is hexyl 4-oxo-4-phenylbutanoate.
What is the SMILES notation for hexyl 4-oxo-4-phenylbutanoate?
The canonical SMILES for hexyl 4-oxo-4-phenylbutanoate is CCCCCCOC(=O)CCC(=O)c1ccccc1.
What is the InChIKey of hexyl 4-oxo-4-phenylbutanoate?
The InChIKey is IAEQYGYQJWEOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-2-3-4-8-13-19-16(18)12-11-15(17)14-9-6-5-7-10-14/h5-7,9-10H,2-4,8,11-13H2,1H3.
What are the key properties of hexyl 4-oxo-4-phenylbutanoate?
hexyl 4-oxo-4-phenylbutanoate has a molecular weight of 262.35 g/mol, XLogP of 3.77, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 4-oxo-4-phenylbutanoate is sourced from PubChem (CID 12510433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).