About (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate
(4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate (PubChem CID 101243722) has the molecular formula C20H20O4
and a molecular weight of 324.38 g/mol. Its IUPAC name is (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate.
Molecular Properties
| Compound Name | (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate |
| PubChem CID | 101243722 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate |
| SMILES | O=C(CCC(=O)c1ccccc1)OCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O4/c21-18(16-8-3-1-4-9-16)12-7-15-24-20(23)14-13-19(22)17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2 |
| InChIKey | LKNUEQSDQHHUKG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate?
The IUPAC name of (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate (CID 101243722) is (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate.
What is the SMILES notation for (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate?
The canonical SMILES for (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate is O=C(CCC(=O)c1ccccc1)OCCCC(=O)c1ccccc1.
What is the InChIKey of (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate?
The InChIKey is LKNUEQSDQHHUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O4/c21-18(16-8-3-1-4-9-16)12-7-15-24-20(23)14-13-19(22)17-10-5-2-6-11-17/h1-6,8-11H,7,12-15H2.
What are the key properties of (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate?
(4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate has a molecular weight of 324.38 g/mol, XLogP of 3.86, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-4-phenylbutyl) 4-oxo-4-phenylbutanoate is sourced from PubChem (CID 101243722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).