amino 9-oxo-9-phenylnonanoate

C15H21NO3 — CID 174840256

IUPACamino 9-oxo-9-phenylnonanoate
SMILESNOC(=O)CCCCCCCC(=O)c1ccccc1
InChIInChI=1S/C15H21NO3/c16-19-15(18)12-8-3-1-2-7-11-14(17)13-9-5-4-6-10-13/h4-6,9-10H,1-3,7-8,11-12,16H2
InChIKeyNULSABUUFKIJRY-UHFFFAOYSA-N
MW263.34 g/mol
LogP3.02
Rot. Bonds9

About amino 9-oxo-9-phenylnonanoate

amino 9-oxo-9-phenylnonanoate (PubChem CID 174840256) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is amino 9-oxo-9-phenylnonanoate.

Molecular Properties

Compound Nameamino 9-oxo-9-phenylnonanoate
PubChem CID174840256
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Nameamino 9-oxo-9-phenylnonanoate
SMILESNOC(=O)CCCCCCCC(=O)c1ccccc1
InChIInChI=1S/C15H21NO3/c16-19-15(18)12-8-3-1-2-7-11-14(17)13-9-5-4-6-10-13/h4-6,9-10H,1-3,7-8,11-12,16H2
InChIKeyNULSABUUFKIJRY-UHFFFAOYSA-N
XLogP3.02
TPSA69.39 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 9-oxo-9-phenylnonanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 9-oxo-9-phenylnonanoate?
The IUPAC name of amino 9-oxo-9-phenylnonanoate (CID 174840256) is amino 9-oxo-9-phenylnonanoate.
What is the SMILES notation for amino 9-oxo-9-phenylnonanoate?
The canonical SMILES for amino 9-oxo-9-phenylnonanoate is NOC(=O)CCCCCCCC(=O)c1ccccc1.
What is the InChIKey of amino 9-oxo-9-phenylnonanoate?
The InChIKey is NULSABUUFKIJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c16-19-15(18)12-8-3-1-2-7-11-14(17)13-9-5-4-6-10-13/h4-6,9-10H,1-3,7-8,11-12,16H2.
What are the key properties of amino 9-oxo-9-phenylnonanoate?
amino 9-oxo-9-phenylnonanoate has a molecular weight of 263.34 g/mol, XLogP of 3.02, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 9-oxo-9-phenylnonanoate is sourced from PubChem (CID 174840256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).