About amino 9-oxo-9-phenylnonanoate
amino 9-oxo-9-phenylnonanoate (PubChem CID 174840256) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is amino 9-oxo-9-phenylnonanoate.
Molecular Properties
| Compound Name | amino 9-oxo-9-phenylnonanoate |
| PubChem CID | 174840256 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | amino 9-oxo-9-phenylnonanoate |
| SMILES | NOC(=O)CCCCCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c16-19-15(18)12-8-3-1-2-7-11-14(17)13-9-5-4-6-10-13/h4-6,9-10H,1-3,7-8,11-12,16H2 |
| InChIKey | NULSABUUFKIJRY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 9-oxo-9-phenylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 9-oxo-9-phenylnonanoate?
The IUPAC name of amino 9-oxo-9-phenylnonanoate (CID 174840256) is amino 9-oxo-9-phenylnonanoate.
What is the SMILES notation for amino 9-oxo-9-phenylnonanoate?
The canonical SMILES for amino 9-oxo-9-phenylnonanoate is NOC(=O)CCCCCCCC(=O)c1ccccc1.
What is the InChIKey of amino 9-oxo-9-phenylnonanoate?
The InChIKey is NULSABUUFKIJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c16-19-15(18)12-8-3-1-2-7-11-14(17)13-9-5-4-6-10-13/h4-6,9-10H,1-3,7-8,11-12,16H2.
What are the key properties of amino 9-oxo-9-phenylnonanoate?
amino 9-oxo-9-phenylnonanoate has a molecular weight of 263.34 g/mol, XLogP of 3.02, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 9-oxo-9-phenylnonanoate is sourced from PubChem (CID 174840256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).