About methanol;pentyl benzoate
methanol;pentyl benzoate (PubChem CID 175222419) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is methanol;pentyl benzoate.
Molecular Properties
| Compound Name | methanol;pentyl benzoate |
| PubChem CID | 175222419 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | methanol;pentyl benzoate |
| SMILES | CCCCCOC(=O)c1ccccc1.CO |
| InChI | InChI=1S/C12H16O2.CH4O/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11;1-2/h4-6,8-9H,2-3,7,10H2,1H3;2H,1H3 |
| InChIKey | JYGHUQYYSJQQGG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanol;pentyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;pentyl benzoate?
The IUPAC name of methanol;pentyl benzoate (CID 175222419) is methanol;pentyl benzoate.
What is the SMILES notation for methanol;pentyl benzoate?
The canonical SMILES for methanol;pentyl benzoate is CCCCCOC(=O)c1ccccc1.CO.
What is the InChIKey of methanol;pentyl benzoate?
The InChIKey is JYGHUQYYSJQQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2.CH4O/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11;1-2/h4-6,8-9H,2-3,7,10H2,1H3;2H,1H3.
What are the key properties of methanol;pentyl benzoate?
methanol;pentyl benzoate has a molecular weight of 224.30 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;pentyl benzoate is sourced from PubChem (CID 175222419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).