About (111C)butyl benzoate
(111C)butyl benzoate (PubChem CID 11994383) has the molecular formula C11H14O2
and a molecular weight of 177.23 g/mol. Its IUPAC name is (111C)butyl benzoate.
Molecular Properties
| Compound Name | (111C)butyl benzoate |
| PubChem CID | 11994383 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | (111C)butyl benzoate |
| SMILES | CCC[11CH2]OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-2-3-9-13-11(12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3/i9-1 |
| InChIKey | XSIFPSYPOVKYCO-RVRFMXCPSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (111C)butyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (111C)butyl benzoate?
The IUPAC name of (111C)butyl benzoate (CID 11994383) is (111C)butyl benzoate.
What is the SMILES notation for (111C)butyl benzoate?
The canonical SMILES for (111C)butyl benzoate is CCC[11CH2]OC(=O)c1ccccc1.
What is the InChIKey of (111C)butyl benzoate?
The InChIKey is XSIFPSYPOVKYCO-RVRFMXCPSA-N. The full InChI is InChI=1S/C11H14O2/c1-2-3-9-13-11(12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3/i9-1.
What are the key properties of (111C)butyl benzoate?
(111C)butyl benzoate has a molecular weight of 177.23 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (111C)butyl benzoate is sourced from PubChem (CID 11994383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).