About butyl benzoate;methane
butyl benzoate;methane (PubChem CID 174523775) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is butyl benzoate;methane.
Molecular Properties
| Compound Name | butyl benzoate;methane |
| PubChem CID | 174523775 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | butyl benzoate;methane |
| SMILES | C.CCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2.CH4/c1-2-3-9-13-11(12)10-7-5-4-6-8-10;/h4-8H,2-3,9H2,1H3;1H4 |
| InChIKey | MAAOCNLAPZTADV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl benzoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl benzoate;methane?
The IUPAC name of butyl benzoate;methane (CID 174523775) is butyl benzoate;methane.
What is the SMILES notation for butyl benzoate;methane?
The canonical SMILES for butyl benzoate;methane is C.CCCCOC(=O)c1ccccc1.
What is the InChIKey of butyl benzoate;methane?
The InChIKey is MAAOCNLAPZTADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.CH4/c1-2-3-9-13-11(12)10-7-5-4-6-8-10;/h4-8H,2-3,9H2,1H3;1H4.
What are the key properties of butyl benzoate;methane?
butyl benzoate;methane has a molecular weight of 194.27 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl benzoate;methane is sourced from PubChem (CID 174523775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).