About 1,1'-biphenyl;butyl benzoate
1,1'-biphenyl;butyl benzoate (PubChem CID 67401065) has the molecular formula C23H24O2
and a molecular weight of 332.44 g/mol. Its IUPAC name is 1,1'-biphenyl;butyl benzoate.
Molecular Properties
| Compound Name | 1,1'-biphenyl;butyl benzoate |
| PubChem CID | 67401065 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1,1'-biphenyl;butyl benzoate |
| SMILES | CCCCOC(=O)c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H14O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-9-13-11(12)10-7-5-4-6-8-10/h1-10H;4-8H,2-3,9H2,1H3 |
| InChIKey | FWQMFABUDACKBR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;butyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;butyl benzoate?
The IUPAC name of 1,1'-biphenyl;butyl benzoate (CID 67401065) is 1,1'-biphenyl;butyl benzoate.
What is the SMILES notation for 1,1'-biphenyl;butyl benzoate?
The canonical SMILES for 1,1'-biphenyl;butyl benzoate is CCCCOC(=O)c1ccccc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;butyl benzoate?
The InChIKey is FWQMFABUDACKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C11H14O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-9-13-11(12)10-7-5-4-6-8-10/h1-10H;4-8H,2-3,9H2,1H3.
What are the key properties of 1,1'-biphenyl;butyl benzoate?
1,1'-biphenyl;butyl benzoate has a molecular weight of 332.44 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;butyl benzoate is sourced from PubChem (CID 67401065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).