About sodium;dodecyl benzoate;benzoate
sodium;dodecyl benzoate;benzoate (PubChem CID 146467201) has the molecular formula C26H35NaO4
and a molecular weight of 434.55 g/mol. Its IUPAC name is sodium;dodecyl benzoate;benzoate.
Molecular Properties
| Compound Name | sodium;dodecyl benzoate;benzoate |
| PubChem CID | 146467201 |
| Molecular Formula | C26H35NaO4 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | sodium;dodecyl benzoate;benzoate |
| SMILES | CCCCCCCCCCCCOC(=O)c1ccccc1.O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C19H30O2.C7H6O2.Na/c1-2-3-4-5-6-7-8-9-10-14-17-21-19(20)18-15-12-11-13-16-18;8-7(9)6-4-2-1-3-5-6;/h11-13,15-16H,2-10,14,17H2,1H3;1-5H,(H,8,9);/q;;+1/p-1 |
| InChIKey | QDLCKRYHZUJDSL-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecyl benzoate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecyl benzoate;benzoate?
The IUPAC name of sodium;dodecyl benzoate;benzoate (CID 146467201) is sodium;dodecyl benzoate;benzoate.
What is the SMILES notation for sodium;dodecyl benzoate;benzoate?
The canonical SMILES for sodium;dodecyl benzoate;benzoate is CCCCCCCCCCCCOC(=O)c1ccccc1.O=C([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;dodecyl benzoate;benzoate?
The InChIKey is QDLCKRYHZUJDSL-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H30O2.C7H6O2.Na/c1-2-3-4-5-6-7-8-9-10-14-17-21-19(20)18-15-12-11-13-16-18;8-7(9)6-4-2-1-3-5-6;/h11-13,15-16H,2-10,14,17H2,1H3;1-5H,(H,8,9);/q;;+1/p-1.
What are the key properties of sodium;dodecyl benzoate;benzoate?
sodium;dodecyl benzoate;benzoate has a molecular weight of 434.55 g/mol, XLogP of 2.82, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecyl benzoate;benzoate is sourced from PubChem (CID 146467201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).