About hexane;1-phenylethanone
hexane;1-phenylethanone (PubChem CID 160797049) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is hexane;1-phenylethanone.
Molecular Properties
| Compound Name | hexane;1-phenylethanone |
| PubChem CID | 160797049 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | hexane;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.CCCCCC |
| InChI | InChI=1S/C8H8O.C6H14/c1-7(9)8-5-3-2-4-6-8;1-3-5-6-4-2/h2-6H,1H3;3-6H2,1-2H3 |
| InChIKey | SCOPXWVCQXUSKE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;1-phenylethanone?
The IUPAC name of hexane;1-phenylethanone (CID 160797049) is hexane;1-phenylethanone.
What is the SMILES notation for hexane;1-phenylethanone?
The canonical SMILES for hexane;1-phenylethanone is CC(=O)c1ccccc1.CCCCCC.
What is the InChIKey of hexane;1-phenylethanone?
The InChIKey is SCOPXWVCQXUSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H14/c1-7(9)8-5-3-2-4-6-8;1-3-5-6-4-2/h2-6H,1H3;3-6H2,1-2H3.
What are the key properties of hexane;1-phenylethanone?
hexane;1-phenylethanone has a molecular weight of 206.33 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;1-phenylethanone is sourced from PubChem (CID 160797049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).