About acetic acid;1-phenylethanone
acetic acid;1-phenylethanone (PubChem CID 159392478) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is acetic acid;1-phenylethanone.
Molecular Properties
| Compound Name | acetic acid;1-phenylethanone |
| PubChem CID | 159392478 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | acetic acid;1-phenylethanone |
| SMILES | CC(=O)O.CC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O.C2H4O2/c1-7(9)8-5-3-2-4-6-8;1-2(3)4/h2-6H,1H3;1H3,(H,3,4) |
| InChIKey | LMHHWMDDYJVICX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-phenylethanone?
The IUPAC name of acetic acid;1-phenylethanone (CID 159392478) is acetic acid;1-phenylethanone.
What is the SMILES notation for acetic acid;1-phenylethanone?
The canonical SMILES for acetic acid;1-phenylethanone is CC(=O)O.CC(=O)c1ccccc1.
What is the InChIKey of acetic acid;1-phenylethanone?
The InChIKey is LMHHWMDDYJVICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H4O2/c1-7(9)8-5-3-2-4-6-8;1-2(3)4/h2-6H,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-phenylethanone?
acetic acid;1-phenylethanone has a molecular weight of 180.20 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-phenylethanone is sourced from PubChem (CID 159392478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).