About 1,1'-biphenyl;ethane;bis(1-phenylethanone)
1,1'-biphenyl;ethane;bis(1-phenylethanone) (PubChem CID 90714339) has the molecular formula C32H38O2
and a molecular weight of 454.65 g/mol. Its IUPAC name is 1,1'-biphenyl;ethane;bis(1-phenylethanone).
Molecular Properties
| Compound Name | 1,1'-biphenyl;ethane;bis(1-phenylethanone) |
| PubChem CID | 90714339 |
| Molecular Formula | C32H38O2 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 1,1'-biphenyl;ethane;bis(1-phenylethanone) |
| SMILES | CC.CC.CC(=O)c1ccccc1.CC(=O)c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C8H8O.2C2H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-7(9)8-5-3-2-4-6-8;2*1-2/h1-10H;2*2-6H,1H3;2*1-2H3 |
| InChIKey | TWFSUKNOMYBYHH-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;ethane;bis(1-phenylethanone) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;ethane;bis(1-phenylethanone)?
The IUPAC name of 1,1'-biphenyl;ethane;bis(1-phenylethanone) (CID 90714339) is 1,1'-biphenyl;ethane;bis(1-phenylethanone).
What is the SMILES notation for 1,1'-biphenyl;ethane;bis(1-phenylethanone)?
The canonical SMILES for 1,1'-biphenyl;ethane;bis(1-phenylethanone) is CC.CC.CC(=O)c1ccccc1.CC(=O)c1ccccc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;ethane;bis(1-phenylethanone)?
The InChIKey is TWFSUKNOMYBYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.2C8H8O.2C2H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-7(9)8-5-3-2-4-6-8;2*1-2/h1-10H;2*2-6H,1H3;2*1-2H3.
What are the key properties of 1,1'-biphenyl;ethane;bis(1-phenylethanone)?
1,1'-biphenyl;ethane;bis(1-phenylethanone) has a molecular weight of 454.65 g/mol, XLogP of 9.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;ethane;bis(1-phenylethanone) is sourced from PubChem (CID 90714339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).