About iron;1-phenylethanone
iron;1-phenylethanone (PubChem CID 70488357) has the molecular formula C8H8FeO
and a molecular weight of 176.00 g/mol. Its IUPAC name is iron;1-phenylethanone.
Molecular Properties
| Compound Name | iron;1-phenylethanone |
| PubChem CID | 70488357 |
| Molecular Formula | C8H8FeO |
| Molecular Weight | 176.00 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | iron;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.[Fe] |
| InChI | InChI=1S/C8H8O.Fe/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H3; |
| InChIKey | JUUVSBWSUZSUIG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.00 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;1-phenylethanone?
The IUPAC name of iron;1-phenylethanone (CID 70488357) is iron;1-phenylethanone.
What is the SMILES notation for iron;1-phenylethanone?
The canonical SMILES for iron;1-phenylethanone is CC(=O)c1ccccc1.[Fe].
What is the InChIKey of iron;1-phenylethanone?
The InChIKey is JUUVSBWSUZSUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.Fe/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H3;.
What are the key properties of iron;1-phenylethanone?
iron;1-phenylethanone has a molecular weight of 176.00 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iron;1-phenylethanone is sourced from PubChem (CID 70488357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).