About ethane;2-methylpropan-2-ol;1-phenylethanone
ethane;2-methylpropan-2-ol;1-phenylethanone (PubChem CID 91393199) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is ethane;2-methylpropan-2-ol;1-phenylethanone.
Molecular Properties
| Compound Name | ethane;2-methylpropan-2-ol;1-phenylethanone |
| PubChem CID | 91393199 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | ethane;2-methylpropan-2-ol;1-phenylethanone |
| SMILES | CC.CC(=O)c1ccccc1.CC(C)(C)O |
| InChI | InChI=1S/C8H8O.C4H10O.C2H6/c1-7(9)8-5-3-2-4-6-8;1-4(2,3)5;1-2/h2-6H,1H3;5H,1-3H3;1-2H3 |
| InChIKey | NDFYRBSZPOMZOH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylpropan-2-ol;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropan-2-ol;1-phenylethanone?
The IUPAC name of ethane;2-methylpropan-2-ol;1-phenylethanone (CID 91393199) is ethane;2-methylpropan-2-ol;1-phenylethanone.
What is the SMILES notation for ethane;2-methylpropan-2-ol;1-phenylethanone?
The canonical SMILES for ethane;2-methylpropan-2-ol;1-phenylethanone is CC.CC(=O)c1ccccc1.CC(C)(C)O.
What is the InChIKey of ethane;2-methylpropan-2-ol;1-phenylethanone?
The InChIKey is NDFYRBSZPOMZOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H10O.C2H6/c1-7(9)8-5-3-2-4-6-8;1-4(2,3)5;1-2/h2-6H,1H3;5H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropan-2-ol;1-phenylethanone?
ethane;2-methylpropan-2-ol;1-phenylethanone has a molecular weight of 224.34 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropan-2-ol;1-phenylethanone is sourced from PubChem (CID 91393199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).