C20H38O — CID 157312693
ethane;1-phenylethanone;2,2,3,3-tetramethylbutane (PubChem CID 157312693) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is ethane;1-phenylethanone;2,2,3,3-tetramethylbutane.
| Compound Name | ethane;1-phenylethanone;2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 157312693 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | ethane;1-phenylethanone;2,2,3,3-tetramethylbutane |
| SMILES | CC.CC.CC(=O)c1ccccc1.CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C8H8O.C8H18.2C2H6/c1-7(9)8-5-3-2-4-6-8;1-7(2,3)8(4,5)6;2*1-2/h2-6H,1H3;1-6H3;2*1-2H3 |
| InChIKey | BDFLRKMGHMELFC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |