C16H13Br3O2 — CID 23466177
1-phenylethanone;2,2,2-tribromo-1-phenylethanone (PubChem CID 23466177) has the molecular formula C16H13Br3O2 and a molecular weight of 476.99 g/mol. Its IUPAC name is 1-phenylethanone;2,2,2-tribromo-1-phenylethanone.
| Compound Name | 1-phenylethanone;2,2,2-tribromo-1-phenylethanone |
|---|---|
| PubChem CID | 23466177 |
| Molecular Formula | C16H13Br3O2 |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 473.85 |
| IUPAC Name | 1-phenylethanone;2,2,2-tribromo-1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C(c1ccccc1)C(Br)(Br)Br |
| InChI | InChI=1S/C8H5Br3O.C8H8O/c9-8(10,11)7(12)6-4-2-1-3-5-6;1-7(9)8-5-3-2-4-6-8/h1-5H;2-6H,1H3 |
| InChIKey | LCODSZBDNPMCDT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|