C10H11Br3O — CID 159508588
ethane;2,2,2-tribromo-1-phenylethanone (PubChem CID 159508588) has the molecular formula C10H11Br3O and a molecular weight of 386.91 g/mol. Its IUPAC name is ethane;2,2,2-tribromo-1-phenylethanone.
| Compound Name | ethane;2,2,2-tribromo-1-phenylethanone |
|---|---|
| PubChem CID | 159508588 |
| Molecular Formula | C10H11Br3O |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | ethane;2,2,2-tribromo-1-phenylethanone |
| SMILES | CC.O=C(c1ccccc1)C(Br)(Br)Br |
| InChI | InChI=1S/C8H5Br3O.C2H6/c9-8(10,11)7(12)6-4-2-1-3-5-6;1-2/h1-5H;1-2H3 |
| InChIKey | MAHTYOXWVYLSTQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|