C15H10F2O2 — CID 3317886
2,2-difluoro-1,3-diphenylpropane-1,3-dione (PubChem CID 3317886) has the molecular formula C15H10F2O2 and a molecular weight of 260.24 g/mol. Its IUPAC name is 2,2-difluoro-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2,2-difluoro-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 3317886 |
| Molecular Formula | C15H10F2O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2,2-difluoro-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(F)(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H10F2O2/c16-15(17,13(18)11-7-3-1-4-8-11)14(19)12-9-5-2-6-10-12/h1-10H |
| InChIKey | JOVRDMZVXGHYHX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|