C10H8F2O2 — CID 14793037
2,2-difluoro-1-phenylbutane-1,3-dione (PubChem CID 14793037) has the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. Its IUPAC name is 2,2-difluoro-1-phenylbutane-1,3-dione.
| Compound Name | 2,2-difluoro-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 14793037 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2,2-difluoro-1-phenylbutane-1,3-dione |
| SMILES | CC(=O)C(F)(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H8F2O2/c1-7(13)10(11,12)9(14)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | BAMPPWBGPVMCLP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|