C12H10F6O — CID 71529526
1-phenyl-2,2-bis(trifluoromethyl)butan-1-one (PubChem CID 71529526) has the molecular formula C12H10F6O and a molecular weight of 284.20 g/mol. Its IUPAC name is 1-phenyl-2,2-bis(trifluoromethyl)butan-1-one.
| Compound Name | 1-phenyl-2,2-bis(trifluoromethyl)butan-1-one |
|---|---|
| PubChem CID | 71529526 |
| Molecular Formula | C12H10F6O |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-phenyl-2,2-bis(trifluoromethyl)butan-1-one |
| SMILES | CCC(C(=O)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F6O/c1-2-10(11(13,14)15,12(16,17)18)9(19)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | IDEXNCRWFNACHC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |