C12H10F4O3 — CID 15698185
ethyl 2-benzoyl-2,3,3,3-tetrafluoropropanoate (PubChem CID 15698185) has the molecular formula C12H10F4O3 and a molecular weight of 278.20 g/mol. Its IUPAC name is ethyl 2-benzoyl-2,3,3,3-tetrafluoropropanoate.
| Compound Name | ethyl 2-benzoyl-2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 15698185 |
| Molecular Formula | C12H10F4O3 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | ethyl 2-benzoyl-2,3,3,3-tetrafluoropropanoate |
| SMILES | CCOC(=O)C(F)(C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H10F4O3/c1-2-19-10(18)11(13,12(14,15)16)9(17)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | AOLSMISUUGJAOS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|