About 2,2-difluoro-1-phenylhexane-1,5-dione
2,2-difluoro-1-phenylhexane-1,5-dione (PubChem CID 10561190) has the molecular formula C12H12F2O2
and a molecular weight of 226.22 g/mol. Its IUPAC name is 2,2-difluoro-1-phenylhexane-1,5-dione.
Molecular Properties
| Compound Name | 2,2-difluoro-1-phenylhexane-1,5-dione |
| PubChem CID | 10561190 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,2-difluoro-1-phenylhexane-1,5-dione |
| SMILES | CC(=O)CCC(F)(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12F2O2/c1-9(15)7-8-12(13,14)11(16)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | FVYHWWMYYAUALC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-1-phenylhexane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1-phenylhexane-1,5-dione?
The IUPAC name of 2,2-difluoro-1-phenylhexane-1,5-dione (CID 10561190) is 2,2-difluoro-1-phenylhexane-1,5-dione.
What is the SMILES notation for 2,2-difluoro-1-phenylhexane-1,5-dione?
The canonical SMILES for 2,2-difluoro-1-phenylhexane-1,5-dione is CC(=O)CCC(F)(F)C(=O)c1ccccc1.
What is the InChIKey of 2,2-difluoro-1-phenylhexane-1,5-dione?
The InChIKey is FVYHWWMYYAUALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O2/c1-9(15)7-8-12(13,14)11(16)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What are the key properties of 2,2-difluoro-1-phenylhexane-1,5-dione?
2,2-difluoro-1-phenylhexane-1,5-dione has a molecular weight of 226.22 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1-phenylhexane-1,5-dione is sourced from PubChem (CID 10561190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).