C12H12F2O2 — CID 10561190
2,2-difluoro-1-phenylhexane-1,5-dione (PubChem CID 10561190) has the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. Its IUPAC name is 2,2-difluoro-1-phenylhexane-1,5-dione.
| Compound Name | 2,2-difluoro-1-phenylhexane-1,5-dione |
|---|---|
| PubChem CID | 10561190 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,2-difluoro-1-phenylhexane-1,5-dione |
| SMILES | CC(=O)CCC(F)(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12F2O2/c1-9(15)7-8-12(13,14)11(16)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | FVYHWWMYYAUALC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |