C13H16O2 — CID 11333176
1-phenylheptane-1,6-dione (PubChem CID 11333176) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-phenylheptane-1,6-dione.
| Compound Name | 1-phenylheptane-1,6-dione |
|---|---|
| PubChem CID | 11333176 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-phenylheptane-1,6-dione |
| SMILES | CC(=O)CCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-11(14)7-5-6-10-13(15)12-8-3-2-4-9-12/h2-4,8-9H,5-7,10H2,1H3 |
| InChIKey | WMQUXDYWSTWBNC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|