C20H20O3 — CID 140639735
1,8-diphenyloctane-1,3,8-trione (PubChem CID 140639735) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1,8-diphenyloctane-1,3,8-trione.
| Compound Name | 1,8-diphenyloctane-1,3,8-trione |
|---|---|
| PubChem CID | 140639735 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1,8-diphenyloctane-1,3,8-trione |
| SMILES | O=C(CCCCC(=O)c1ccccc1)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O3/c21-18(15-20(23)17-11-5-2-6-12-17)13-7-8-14-19(22)16-9-3-1-4-10-16/h1-6,9-12H,7-8,13-15H2 |
| InChIKey | CXVBRJUZCYVGEJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|