C30H24O4Zn — CID 67929938
bis(1,3-diphenylpropane-1,3-dione);zinc (PubChem CID 67929938) has the molecular formula C30H24O4Zn and a molecular weight of 513.91 g/mol. Its IUPAC name is bis(1,3-diphenylpropane-1,3-dione);zinc.
| Compound Name | bis(1,3-diphenylpropane-1,3-dione);zinc |
|---|---|
| PubChem CID | 67929938 |
| Molecular Formula | C30H24O4Zn |
| Molecular Weight | 513.91 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | bis(1,3-diphenylpropane-1,3-dione);zinc |
| SMILES | O=C(CC(=O)c1ccccc1)c1ccccc1.O=C(CC(=O)c1ccccc1)c1ccccc1.[Zn] |
| InChI | InChI=1S/2C15H12O2.Zn/c2*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h2*1-10H,11H2; |
| InChIKey | XBSYHTQQFQZKNP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|