C10H7CrO4+2 — CID 172832057
chromium(3+);2,4-dioxo-4-phenylbutanoate (PubChem CID 172832057) has the molecular formula C10H7CrO4+2 and a molecular weight of 243.16 g/mol. Its IUPAC name is chromium(3+);2,4-dioxo-4-phenylbutanoate.
| Compound Name | chromium(3+);2,4-dioxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 172832057 |
| Molecular Formula | C10H7CrO4+2 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | chromium(3+);2,4-dioxo-4-phenylbutanoate |
| SMILES | O=C([O-])C(=O)CC(=O)c1ccccc1.[Cr+3] |
| InChI | InChI=1S/C10H8O4.Cr/c11-8(6-9(12)10(13)14)7-4-2-1-3-5-7;/h1-5H,6H2,(H,13,14);/q;+3/p-1 |
| InChIKey | VQJVJIIJKRICIT-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|