C12H12O2 — CID 15683513
4-methyl-1-phenylpent-4-ene-1,3-dione (PubChem CID 15683513) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-methyl-1-phenylpent-4-ene-1,3-dione.
| Compound Name | 4-methyl-1-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 15683513 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-methyl-1-phenylpent-4-ene-1,3-dione |
| SMILES | C=C(C)C(=O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-9(2)11(13)8-12(14)10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 |
| InChIKey | CAKVQONFSGLJGN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|