C20H14CoO8 — CID 175080767
cobalt(2+);bis(2,4-dioxo-4-phenylbutanoate) (PubChem CID 175080767) has the molecular formula C20H14CoO8 and a molecular weight of 441.26 g/mol. Its IUPAC name is cobalt(2+);bis(2,4-dioxo-4-phenylbutanoate).
| Compound Name | cobalt(2+);bis(2,4-dioxo-4-phenylbutanoate) |
|---|---|
| PubChem CID | 175080767 |
| Molecular Formula | C20H14CoO8 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | cobalt(2+);bis(2,4-dioxo-4-phenylbutanoate) |
| SMILES | O=C([O-])C(=O)CC(=O)c1ccccc1.O=C([O-])C(=O)CC(=O)c1ccccc1.[Co+2] |
| InChI | InChI=1S/2C10H8O4.Co/c2*11-8(6-9(12)10(13)14)7-4-2-1-3-5-7;/h2*1-5H,6H2,(H,13,14);/q;;+2/p-2 |
| InChIKey | OBECXIUTEDWOCM-UHFFFAOYSA-L |
| XLogP | -0.85 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|