About 3-oxo-3-phenylpropanoic acid;silver
3-oxo-3-phenylpropanoic acid;silver (PubChem CID 87120895) has the molecular formula C9H8AgO3
and a molecular weight of 272.03 g/mol. Its IUPAC name is 3-oxo-3-phenylpropanoic acid;silver.
Molecular Properties
| Compound Name | 3-oxo-3-phenylpropanoic acid;silver |
| PubChem CID | 87120895 |
| Molecular Formula | C9H8AgO3 |
| Molecular Weight | 272.03 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 3-oxo-3-phenylpropanoic acid;silver |
| SMILES | O=C(O)CC(=O)c1ccccc1.[Ag] |
| InChI | InChI=1S/C9H8O3.Ag/c10-8(6-9(11)12)7-4-2-1-3-5-7;/h1-5H,6H2,(H,11,12); |
| InChIKey | GWEAPQJDUBBIEY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.03 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-3-phenylpropanoic acid;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-3-phenylpropanoic acid;silver?
The IUPAC name of 3-oxo-3-phenylpropanoic acid;silver (CID 87120895) is 3-oxo-3-phenylpropanoic acid;silver.
What is the SMILES notation for 3-oxo-3-phenylpropanoic acid;silver?
The canonical SMILES for 3-oxo-3-phenylpropanoic acid;silver is O=C(O)CC(=O)c1ccccc1.[Ag].
What is the InChIKey of 3-oxo-3-phenylpropanoic acid;silver?
The InChIKey is GWEAPQJDUBBIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3.Ag/c10-8(6-9(11)12)7-4-2-1-3-5-7;/h1-5H,6H2,(H,11,12);.
What are the key properties of 3-oxo-3-phenylpropanoic acid;silver?
3-oxo-3-phenylpropanoic acid;silver has a molecular weight of 272.03 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-3-phenylpropanoic acid;silver is sourced from PubChem (CID 87120895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).