C15H12O3 — CID 10354535
1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-3-(2-hydroxyphenyl)propane-1,3-dione (PubChem CID 10354535) has the molecular formula C15H12O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-3-(2-hydroxyphenyl)propane-1,3-dione.
| Compound Name | 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 10354535 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)[13c]1[13cH][13cH][13cH][13cH][13cH]1)c1ccccc1O |
| InChI | InChI=1S/C15H12O3/c16-13-9-5-4-8-12(13)15(18)10-14(17)11-6-2-1-3-7-11/h1-9,16H,10H2/i1+1,2+1,3+1,6+1,7+1,11+1 |
| InChIKey | OABFIJGAEVKMJP-UJVDBDNBSA-N |
| XLogP | 2.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|