C16H14O4 — CID 11414548
1-(2-hydroxy-4-methoxyphenyl)-3-phenylpropane-1,3-dione (PubChem CID 11414548) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-(2-hydroxy-4-methoxyphenyl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(2-hydroxy-4-methoxyphenyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 11414548 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-(2-hydroxy-4-methoxyphenyl)-3-phenylpropane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H14O4/c1-20-12-7-8-13(15(18)9-12)16(19)10-14(17)11-5-3-2-4-6-11/h2-9,18H,10H2,1H3 |
| InChIKey | JZKDEMPGCWWFCP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|