About (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride
(2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride (PubChem CID 158222494) has the molecular formula C17H22ClNO3
and a molecular weight of 323.82 g/mol. Its IUPAC name is (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride |
| PubChem CID | 158222494 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride |
| SMILES | CCCN.COc1ccc(C(=O)c2ccccc2)c(O)c1.Cl |
| InChI | InChI=1S/C14H12O3.C3H9N.ClH/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10;1-2-3-4;/h2-9,15H,1H3;2-4H2,1H3;1H |
| InChIKey | DFABHPWIVIRZNE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride?
The IUPAC name of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride (CID 158222494) is (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride.
What is the SMILES notation for (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride?
The canonical SMILES for (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride is CCCN.COc1ccc(C(=O)c2ccccc2)c(O)c1.Cl.
What is the InChIKey of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride?
The InChIKey is DFABHPWIVIRZNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3.C3H9N.ClH/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10;1-2-3-4;/h2-9,15H,1H3;2-4H2,1H3;1H.
What are the key properties of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride?
(2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride has a molecular weight of 323.82 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4-methoxyphenyl)-phenylmethanone;propan-1-amine;hydrochloride is sourced from PubChem (CID 158222494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).