C14H12Na2O3 — CID 172864174
CID 172864174 (PubChem CID 172864174) has the molecular formula C14H12Na2O3 and a molecular weight of 274.23 g/mol.
| Compound Name | CID 172864174 |
|---|---|
| PubChem CID | 172864174 |
| Molecular Formula | C14H12Na2O3 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(O)c1.[Na].[Na] |
| InChI | InChI=1S/C14H12O3.2Na/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10;;/h2-9,15H,1H3;; |
| InChIKey | ZTKZOZOPACHNPT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |