About (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid
(2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid (PubChem CID 158503337) has the molecular formula C24H22O6
and a molecular weight of 406.43 g/mol. Its IUPAC name is (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid |
| PubChem CID | 158503337 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid |
| SMILES | COC(=Cc1ccccc1)C(=O)O.COc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C14H12O3.C10H10O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10;1-13-9(10(11)12)7-8-5-3-2-4-6-8/h2-9,15H,1H3;2-7H,1H3,(H,11,12) |
| InChIKey | HKEBDKYMCPJTRM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid?
The IUPAC name of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid (CID 158503337) is (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid.
What is the SMILES notation for (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid?
The canonical SMILES for (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid is COC(=Cc1ccccc1)C(=O)O.COc1ccc(C(=O)c2ccccc2)c(O)c1.
What is the InChIKey of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid?
The InChIKey is HKEBDKYMCPJTRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3.C10H10O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10;1-13-9(10(11)12)7-8-5-3-2-4-6-8/h2-9,15H,1H3;2-7H,1H3,(H,11,12).
What are the key properties of (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid?
(2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid has a molecular weight of 406.43 g/mol, XLogP of 4.39, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4-methoxyphenyl)-phenylmethanone;2-methoxy-3-phenylprop-2-enoic acid is sourced from PubChem (CID 158503337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).