About 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone
2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone (PubChem CID 118272160) has the molecular formula C30H26O6
and a molecular weight of 482.53 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone.
Molecular Properties
| Compound Name | 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone |
| PubChem CID | 118272160 |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone |
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.COc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H14O3.C14H12O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-11H,1H3,(H,18,19);2-9,15H,1H3 |
| InChIKey | SEHKCERNHROTBK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone?
The IUPAC name of 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone (CID 118272160) is 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone.
What is the SMILES notation for 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone?
The canonical SMILES for 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone is CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.COc1ccc(C(=O)c2ccccc2)c(O)c1.
What is the InChIKey of 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone?
The InChIKey is SEHKCERNHROTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3.C14H12O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-11H,1H3,(H,18,19);2-9,15H,1H3.
What are the key properties of 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone?
2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone has a molecular weight of 482.53 g/mol, XLogP of 5.74, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzoylphenyl)propanoic acid;(2-hydroxy-4-methoxyphenyl)-phenylmethanone is sourced from PubChem (CID 118272160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).