About 2-(3-benzoylphenyl)propanoic acid;phenol
2-(3-benzoylphenyl)propanoic acid;phenol (PubChem CID 161129325) has the molecular formula C22H20O4
and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)propanoic acid;phenol.
Molecular Properties
| Compound Name | 2-(3-benzoylphenyl)propanoic acid;phenol |
| PubChem CID | 161129325 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(3-benzoylphenyl)propanoic acid;phenol |
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.Oc1ccccc1 |
| InChI | InChI=1S/C16H14O3.C6H6O/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;7-6-4-2-1-3-5-6/h2-11H,1H3,(H,18,19);1-5,7H |
| InChIKey | ULYYKJOKMJBFLF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-benzoylphenyl)propanoic acid;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzoylphenyl)propanoic acid;phenol?
The IUPAC name of 2-(3-benzoylphenyl)propanoic acid;phenol (CID 161129325) is 2-(3-benzoylphenyl)propanoic acid;phenol.
What is the SMILES notation for 2-(3-benzoylphenyl)propanoic acid;phenol?
The canonical SMILES for 2-(3-benzoylphenyl)propanoic acid;phenol is CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.Oc1ccccc1.
What is the InChIKey of 2-(3-benzoylphenyl)propanoic acid;phenol?
The InChIKey is ULYYKJOKMJBFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3.C6H6O/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;7-6-4-2-1-3-5-6/h2-11H,1H3,(H,18,19);1-5,7H.
What are the key properties of 2-(3-benzoylphenyl)propanoic acid;phenol?
2-(3-benzoylphenyl)propanoic acid;phenol has a molecular weight of 348.40 g/mol, XLogP of 4.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzoylphenyl)propanoic acid;phenol is sourced from PubChem (CID 161129325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).