C18H19NO2 — CID 3042316
2-(3-benzoylphenyl)-N,N-dimethylpropanamide (PubChem CID 3042316) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)-N,N-dimethylpropanamide.
| Compound Name | 2-(3-benzoylphenyl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 3042316 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(3-benzoylphenyl)-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19NO2/c1-13(18(21)19(2)3)15-10-7-11-16(12-15)17(20)14-8-5-4-6-9-14/h4-13H,1-3H3 |
| InChIKey | ICEJJANOGABWPA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |