About 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate
1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate (PubChem CID 158675776) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate.
Molecular Properties
| Compound Name | 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate |
| PubChem CID | 158675776 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate |
| SMILES | CC(C(=O)[O-])c1cccc(C(=O)c2ccccc2)c1.CC(N)=[NH2+] |
| InChI | InChI=1S/C16H14O3.C2H6N2/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;1-2(3)4/h2-11H,1H3,(H,18,19);1H3,(H3,3,4) |
| InChIKey | IEMQPBAKLJLORR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate?
The IUPAC name of 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate (CID 158675776) is 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate.
What is the SMILES notation for 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate?
The canonical SMILES for 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate is CC(C(=O)[O-])c1cccc(C(=O)c2ccccc2)c1.CC(N)=[NH2+].
What is the InChIKey of 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate?
The InChIKey is IEMQPBAKLJLORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3.C2H6N2/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;1-2(3)4/h2-11H,1H3,(H,18,19);1H3,(H3,3,4).
What are the key properties of 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate?
1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate has a molecular weight of 312.37 g/mol, XLogP of -0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethylideneazanium;2-(3-benzoylphenyl)propanoate is sourced from PubChem (CID 158675776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).