About azane;2-hydroxy-1-phenylethanone
azane;2-hydroxy-1-phenylethanone (PubChem CID 161228887) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is azane;2-hydroxy-1-phenylethanone.
Molecular Properties
| Compound Name | azane;2-hydroxy-1-phenylethanone |
| PubChem CID | 161228887 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | azane;2-hydroxy-1-phenylethanone |
| SMILES | N.O=C(CO)c1ccccc1 |
| InChI | InChI=1S/C8H8O2.H3N/c9-6-8(10)7-4-2-1-3-5-7;/h1-5,9H,6H2;1H3 |
| InChIKey | UYMICZQBUOROQW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2-hydroxy-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-hydroxy-1-phenylethanone?
The IUPAC name of azane;2-hydroxy-1-phenylethanone (CID 161228887) is azane;2-hydroxy-1-phenylethanone.
What is the SMILES notation for azane;2-hydroxy-1-phenylethanone?
The canonical SMILES for azane;2-hydroxy-1-phenylethanone is N.O=C(CO)c1ccccc1.
What is the InChIKey of azane;2-hydroxy-1-phenylethanone?
The InChIKey is UYMICZQBUOROQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.H3N/c9-6-8(10)7-4-2-1-3-5-7;/h1-5,9H,6H2;1H3.
What are the key properties of azane;2-hydroxy-1-phenylethanone?
azane;2-hydroxy-1-phenylethanone has a molecular weight of 153.18 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxy-1-phenylethanone is sourced from PubChem (CID 161228887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).