C12H20N2O2 — CID 159852877
2-hydroxy-1-phenylethanone;2-methylpropane-1,2-diamine (PubChem CID 159852877) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-hydroxy-1-phenylethanone;2-methylpropane-1,2-diamine.
| Compound Name | 2-hydroxy-1-phenylethanone;2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 159852877 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-hydroxy-1-phenylethanone;2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CN.O=C(CO)c1ccccc1 |
| InChI | InChI=1S/C8H8O2.C4H12N2/c9-6-8(10)7-4-2-1-3-5-7;1-4(2,6)3-5/h1-5,9H,6H2;3,5-6H2,1-2H3 |
| InChIKey | NQDWDKUWWYHTPW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |