C25H33N3 — CID 174802109
N,N-dibenzyl-1-phenylmethanamine;2-methylpropane-1,2-diamine (PubChem CID 174802109) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is N,N-dibenzyl-1-phenylmethanamine;2-methylpropane-1,2-diamine.
| Compound Name | N,N-dibenzyl-1-phenylmethanamine;2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 174802109 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N,N-dibenzyl-1-phenylmethanamine;2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CN.c1ccc(CN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N.C4H12N2/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;1-4(2,6)3-5/h1-15H,16-18H2;3,5-6H2,1-2H3 |
| InChIKey | HVRCBBNILREPEM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |